About N-[(2R)-1-[4-(3,5-dichlorophenyl)phenyl]-3-hydroxypropan-2-yl]but-3-enamide
N-[(2R)-1-[4-(3,5-dichlorophenyl)phenyl]-3-hydroxypropan-2-yl]but-3-enamide (PubChem CID 155540884) has the molecular formula C19H19Cl2NO2
and a molecular weight of 364.27 g/mol. Its IUPAC name is N-[(2R)-1-[4-(3,5-dichlorophenyl)phenyl]-3-hydroxypropan-2-yl]but-3-enamide.
Molecular Properties
| Compound Name | N-[(2R)-1-[4-(3,5-dichlorophenyl)phenyl]-3-hydroxypropan-2-yl]but-3-enamide |
| PubChem CID | 155540884 |
| Molecular Formula | C19H19Cl2NO2 |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | N-[(2R)-1-[4-(3,5-dichlorophenyl)phenyl]-3-hydroxypropan-2-yl]but-3-enamide |
| SMILES | C=CCC(=O)N[C@@H](CO)Cc1ccc(-c2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C19H19Cl2NO2/c1-2-3-19(24)22-18(12-23)8-13-4-6-14(7-5-13)15-9-16(20)11-17(21)10-15/h2,4-7,9-11,18,23H,1,3,8,12H2,(H,22,24)/t18-/m1/s1 |
| InChIKey | QQYWTJMLUVDAMH-GOSISDBHSA-N |
| XLogP | 4.26 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2R)-1-[4-(3,5-dichlorophenyl)phenyl]-3-hydroxypropan-2-yl]but-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-1-[4-(3,5-dichlorophenyl)phenyl]-3-hydroxypropan-2-yl]but-3-enamide?
The IUPAC name of N-[(2R)-1-[4-(3,5-dichlorophenyl)phenyl]-3-hydroxypropan-2-yl]but-3-enamide (CID 155540884) is N-[(2R)-1-[4-(3,5-dichlorophenyl)phenyl]-3-hydroxypropan-2-yl]but-3-enamide.
What is the SMILES notation for N-[(2R)-1-[4-(3,5-dichlorophenyl)phenyl]-3-hydroxypropan-2-yl]but-3-enamide?
The canonical SMILES for N-[(2R)-1-[4-(3,5-dichlorophenyl)phenyl]-3-hydroxypropan-2-yl]but-3-enamide is C=CCC(=O)N[C@@H](CO)Cc1ccc(-c2cc(Cl)cc(Cl)c2)cc1.
What is the InChIKey of N-[(2R)-1-[4-(3,5-dichlorophenyl)phenyl]-3-hydroxypropan-2-yl]but-3-enamide?
The InChIKey is QQYWTJMLUVDAMH-GOSISDBHSA-N. The full InChI is InChI=1S/C19H19Cl2NO2/c1-2-3-19(24)22-18(12-23)8-13-4-6-14(7-5-13)15-9-16(20)11-17(21)10-15/h2,4-7,9-11,18,23H,1,3,8,12H2,(H,22,24)/t18-/m1/s1.
What are the key properties of N-[(2R)-1-[4-(3,5-dichlorophenyl)phenyl]-3-hydroxypropan-2-yl]but-3-enamide?
N-[(2R)-1-[4-(3,5-dichlorophenyl)phenyl]-3-hydroxypropan-2-yl]but-3-enamide has a molecular weight of 364.27 g/mol, XLogP of 4.26, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-1-[4-(3,5-dichlorophenyl)phenyl]-3-hydroxypropan-2-yl]but-3-enamide is sourced from PubChem (CID 155540884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).