C33H33F3O7 — CID 155540990
[(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl (E)-3-(2,5-dimethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 155540990) has the molecular formula C33H33F3O7 and a molecular weight of 598.61 g/mol. Its IUPAC name is [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl (E)-3-(2,5-dimethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl (E)-3-(2,5-dimethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 155540990 |
| Molecular Formula | C33H33F3O7 |
| Molecular Weight | 598.61 g/mol |
| Exact Mass | 598.22 |
| IUPAC Name | [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl (E)-3-(2,5-dimethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1CC/C(COC(=O)/C(=C/c1cc(OC)ccc1OC)c1ccc(C(F)(F)F)cc1)=C\CC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C33H33F3O7/c1-19-25-13-7-20(6-5-15-32(2)29(43-32)28(25)42-30(19)37)18-41-31(38)26(21-8-10-23(11-9-21)33(34,35)36)17-22-16-24(39-3)12-14-27(22)40-4/h6,8-12,14,16-17,25,28-29H,1,5,7,13,15,18H2,2-4H3/b20-6+,26-17+/t25-,28-,29-,32+/m0/s1 |
| InChIKey | GQPDFAVJSHMXGB-HWLTWRQWSA-N |
| XLogP | 6.56 |
| TPSA | 83.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.61 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|