About 4-[5-(3,5-dichloro-4-ethoxyphenyl)-1,3-oxazol-2-yl]benzoic acid
4-[5-(3,5-dichloro-4-ethoxyphenyl)-1,3-oxazol-2-yl]benzoic acid (PubChem CID 155540995) has the molecular formula C18H13Cl2NO4
and a molecular weight of 378.21 g/mol. Its IUPAC name is 4-[5-(3,5-dichloro-4-ethoxyphenyl)-1,3-oxazol-2-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[5-(3,5-dichloro-4-ethoxyphenyl)-1,3-oxazol-2-yl]benzoic acid |
| PubChem CID | 155540995 |
| Molecular Formula | C18H13Cl2NO4 |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | 4-[5-(3,5-dichloro-4-ethoxyphenyl)-1,3-oxazol-2-yl]benzoic acid |
| SMILES | CCOc1c(Cl)cc(-c2cnc(-c3ccc(C(=O)O)cc3)o2)cc1Cl |
| InChI | InChI=1S/C18H13Cl2NO4/c1-2-24-16-13(19)7-12(8-14(16)20)15-9-21-17(25-15)10-3-5-11(6-4-10)18(22)23/h3-9H,2H2,1H3,(H,22,23) |
| InChIKey | PNCYUHNQVYHNOF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[5-(3,5-dichloro-4-ethoxyphenyl)-1,3-oxazol-2-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(3,5-dichloro-4-ethoxyphenyl)-1,3-oxazol-2-yl]benzoic acid?
The IUPAC name of 4-[5-(3,5-dichloro-4-ethoxyphenyl)-1,3-oxazol-2-yl]benzoic acid (CID 155540995) is 4-[5-(3,5-dichloro-4-ethoxyphenyl)-1,3-oxazol-2-yl]benzoic acid.
What is the SMILES notation for 4-[5-(3,5-dichloro-4-ethoxyphenyl)-1,3-oxazol-2-yl]benzoic acid?
The canonical SMILES for 4-[5-(3,5-dichloro-4-ethoxyphenyl)-1,3-oxazol-2-yl]benzoic acid is CCOc1c(Cl)cc(-c2cnc(-c3ccc(C(=O)O)cc3)o2)cc1Cl.
What is the InChIKey of 4-[5-(3,5-dichloro-4-ethoxyphenyl)-1,3-oxazol-2-yl]benzoic acid?
The InChIKey is PNCYUHNQVYHNOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Cl2NO4/c1-2-24-16-13(19)7-12(8-14(16)20)15-9-21-17(25-15)10-3-5-11(6-4-10)18(22)23/h3-9H,2H2,1H3,(H,22,23).
What are the key properties of 4-[5-(3,5-dichloro-4-ethoxyphenyl)-1,3-oxazol-2-yl]benzoic acid?
4-[5-(3,5-dichloro-4-ethoxyphenyl)-1,3-oxazol-2-yl]benzoic acid has a molecular weight of 378.21 g/mol, XLogP of 5.41, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(3,5-dichloro-4-ethoxyphenyl)-1,3-oxazol-2-yl]benzoic acid is sourced from PubChem (CID 155540995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).