C41H42BrN3O3 — CID 155541000
(6aR,11bR)-4,9,10-trimethoxy-5-[3-[2-methyl-3-(naphthalen-2-ylmethyl)benzimidazol-3-ium-1-yl]propyl]-6,6a,7,11b-tetrahydroindeno[2,1-c]quinoline bromide (PubChem CID 155541000) has the molecular formula C41H42BrN3O3 and a molecular weight of 704.71 g/mol. Its IUPAC name is (6aR,11bR)-4,9,10-trimethoxy-5-[3-[2-methyl-3-(naphthalen-2-ylmethyl)benzimidazol-3-ium-1-yl]propyl]-6,6a,7,11b-tetrahydroindeno[2,1-c]quinoline bromide.
| Compound Name | (6aR,11bR)-4,9,10-trimethoxy-5-[3-[2-methyl-3-(naphthalen-2-ylmethyl)benzimidazol-3-ium-1-yl]propyl]-6,6a,7,11b-tetrahydroindeno[2,1-c]quinoline bromide |
|---|---|
| PubChem CID | 155541000 |
| Molecular Formula | C41H42BrN3O3 |
| Molecular Weight | 704.71 g/mol |
| Exact Mass | 703.24 |
| IUPAC Name | (6aR,11bR)-4,9,10-trimethoxy-5-[3-[2-methyl-3-(naphthalen-2-ylmethyl)benzimidazol-3-ium-1-yl]propyl]-6,6a,7,11b-tetrahydroindeno[2,1-c]quinoline bromide |
| SMILES | COc1cc2c(cc1OC)[C@@H]1c3cccc(OC)c3N(CCCn3c(C)[n+](Cc4ccc5ccccc5c4)c4ccccc43)C[C@@H]1C2.[Br-] |
| InChI | InChI=1S/C41H42N3O3.BrH/c1-27-43(35-14-7-8-15-36(35)44(27)25-28-17-18-29-11-5-6-12-30(29)21-28)20-10-19-42-26-32-22-31-23-38(46-3)39(47-4)24-34(31)40(32)33-13-9-16-37(45-2)41(33)42;/h5-9,11-18,21,23-24,32,40H,10,19-20,22,25-26H2,1-4H3;1H/q+1;/p-1/t32-,40-;/m0./s1 |
| InChIKey | SMLDFEUNQCSNKK-BSVCGWBRSA-M |
| XLogP | 4.68 |
| TPSA | 39.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.71 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|