C23H16F6N4O3 — CID 155541028
6-methoxy-2-N,3-N-bis[4-(trifluoromethoxy)phenyl]quinoxaline-2,3-diamine (PubChem CID 155541028) has the molecular formula C23H16F6N4O3 and a molecular weight of 510.39 g/mol. Its IUPAC name is 6-methoxy-2-N,3-N-bis[4-(trifluoromethoxy)phenyl]quinoxaline-2,3-diamine.
| Compound Name | 6-methoxy-2-N,3-N-bis[4-(trifluoromethoxy)phenyl]quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 155541028 |
| Molecular Formula | C23H16F6N4O3 |
| Molecular Weight | 510.39 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 6-methoxy-2-N,3-N-bis[4-(trifluoromethoxy)phenyl]quinoxaline-2,3-diamine |
| SMILES | COc1ccc2nc(Nc3ccc(OC(F)(F)F)cc3)c(Nc3ccc(OC(F)(F)F)cc3)nc2c1 |
| InChI | InChI=1S/C23H16F6N4O3/c1-34-17-10-11-18-19(12-17)33-21(31-14-4-8-16(9-5-14)36-23(27,28)29)20(32-18)30-13-2-6-15(7-3-13)35-22(24,25)26/h2-12H,1H3,(H,30,32)(H,31,33) |
| InChIKey | HKYBCJOCIKACOQ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 77.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.39 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |