C22H24O7 — CID 155541030
(10S,15S,16R)-6,15,16-trihydroxy-4-methoxy-10-methyl-9-oxatricyclo[15.3.1.02,7]henicosa-1(21),2(7),3,5,17,19-hexaene-8,14-dione (PubChem CID 155541030) has the molecular formula C22H24O7 and a molecular weight of 400.43 g/mol. Its IUPAC name is (10S,15S,16R)-6,15,16-trihydroxy-4-methoxy-10-methyl-9-oxatricyclo[15.3.1.02,7]henicosa-1(21),2(7),3,5,17,19-hexaene-8,14-dione.
| Compound Name | (10S,15S,16R)-6,15,16-trihydroxy-4-methoxy-10-methyl-9-oxatricyclo[15.3.1.02,7]henicosa-1(21),2(7),3,5,17,19-hexaene-8,14-dione |
|---|---|
| PubChem CID | 155541030 |
| Molecular Formula | C22H24O7 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (10S,15S,16R)-6,15,16-trihydroxy-4-methoxy-10-methyl-9-oxatricyclo[15.3.1.02,7]henicosa-1(21),2(7),3,5,17,19-hexaene-8,14-dione |
| SMILES | COc1cc(O)c2c(c1)-c1cccc(c1)[C@@H](O)[C@H](O)C(=O)CCC[C@H](C)OC2=O |
| InChI | InChI=1S/C22H24O7/c1-12-5-3-8-17(23)21(26)20(25)14-7-4-6-13(9-14)16-10-15(28-2)11-18(24)19(16)22(27)29-12/h4,6-7,9-12,20-21,24-26H,3,5,8H2,1-2H3/t12-,20+,21+/m0/s1 |
| InChIKey | REIUSODTVBSVPQ-WNVHLOTPSA-N |
| XLogP | 2.76 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |