C25H30N6O2S2 — CID 155541046
N-[3-[5-(1,5-dimethylpyrazol-4-yl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide (PubChem CID 155541046) has the molecular formula C25H30N6O2S2 and a molecular weight of 510.69 g/mol. Its IUPAC name is N-[3-[5-(1,5-dimethylpyrazol-4-yl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide.
| Compound Name | N-[3-[5-(1,5-dimethylpyrazol-4-yl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide |
|---|---|
| PubChem CID | 155541046 |
| Molecular Formula | C25H30N6O2S2 |
| Molecular Weight | 510.69 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | N-[3-[5-(1,5-dimethylpyrazol-4-yl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide |
| SMILES | COCCNCCC(=O)Nc1sc2c(c1-c1nc3cc(-c4cnn(C)c4C)ccc3s1)CCNC2 |
| InChI | InChI=1S/C25H30N6O2S2/c1-15-18(13-28-31(15)2)16-4-5-20-19(12-16)29-24(34-20)23-17-6-8-27-14-21(17)35-25(23)30-22(32)7-9-26-10-11-33-3/h4-5,12-13,26-27H,6-11,14H2,1-3H3,(H,30,32) |
| InChIKey | JOTWLGGEWBPFOG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.69 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|