About 2-(7-methoxy-1-methylpyrido[3,4-b]indol-9-yl)acetamide
2-(7-methoxy-1-methylpyrido[3,4-b]indol-9-yl)acetamide (PubChem CID 155541088) has the molecular formula C15H15N3O2
and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-(7-methoxy-1-methylpyrido[3,4-b]indol-9-yl)acetamide.
Molecular Properties
| Compound Name | 2-(7-methoxy-1-methylpyrido[3,4-b]indol-9-yl)acetamide |
| PubChem CID | 155541088 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-(7-methoxy-1-methylpyrido[3,4-b]indol-9-yl)acetamide |
| SMILES | COc1ccc2c3ccnc(C)c3n(CC(N)=O)c2c1 |
| InChI | InChI=1S/C15H15N3O2/c1-9-15-12(5-6-17-9)11-4-3-10(20-2)7-13(11)18(15)8-14(16)19/h3-7H,8H2,1-2H3,(H2,16,19) |
| InChIKey | SOPXXIHSOWBNGI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(7-methoxy-1-methylpyrido[3,4-b]indol-9-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-methoxy-1-methylpyrido[3,4-b]indol-9-yl)acetamide?
The IUPAC name of 2-(7-methoxy-1-methylpyrido[3,4-b]indol-9-yl)acetamide (CID 155541088) is 2-(7-methoxy-1-methylpyrido[3,4-b]indol-9-yl)acetamide.
What is the SMILES notation for 2-(7-methoxy-1-methylpyrido[3,4-b]indol-9-yl)acetamide?
The canonical SMILES for 2-(7-methoxy-1-methylpyrido[3,4-b]indol-9-yl)acetamide is COc1ccc2c3ccnc(C)c3n(CC(N)=O)c2c1.
What is the InChIKey of 2-(7-methoxy-1-methylpyrido[3,4-b]indol-9-yl)acetamide?
The InChIKey is SOPXXIHSOWBNGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O2/c1-9-15-12(5-6-17-9)11-4-3-10(20-2)7-13(11)18(15)8-14(16)19/h3-7H,8H2,1-2H3,(H2,16,19).
What are the key properties of 2-(7-methoxy-1-methylpyrido[3,4-b]indol-9-yl)acetamide?
2-(7-methoxy-1-methylpyrido[3,4-b]indol-9-yl)acetamide has a molecular weight of 269.30 g/mol, XLogP of 1.99, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-methoxy-1-methylpyrido[3,4-b]indol-9-yl)acetamide is sourced from PubChem (CID 155541088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).