About 4-(4-methylsulfonylphenyl)-5,5-diphenylpent-4-en-1-ol
4-(4-methylsulfonylphenyl)-5,5-diphenylpent-4-en-1-ol (PubChem CID 155541121) has the molecular formula C24H24O3S
and a molecular weight of 392.52 g/mol. Its IUPAC name is 4-(4-methylsulfonylphenyl)-5,5-diphenylpent-4-en-1-ol.
Molecular Properties
| Compound Name | 4-(4-methylsulfonylphenyl)-5,5-diphenylpent-4-en-1-ol |
| PubChem CID | 155541121 |
| Molecular Formula | C24H24O3S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 4-(4-methylsulfonylphenyl)-5,5-diphenylpent-4-en-1-ol |
| SMILES | CS(=O)(=O)c1ccc(C(CCCO)=C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24O3S/c1-28(26,27)22-16-14-19(15-17-22)23(13-8-18-25)24(20-9-4-2-5-10-20)21-11-6-3-7-12-21/h2-7,9-12,14-17,25H,8,13,18H2,1H3 |
| InChIKey | UTJHBKNMVJTZMY-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methylsulfonylphenyl)-5,5-diphenylpent-4-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylsulfonylphenyl)-5,5-diphenylpent-4-en-1-ol?
The IUPAC name of 4-(4-methylsulfonylphenyl)-5,5-diphenylpent-4-en-1-ol (CID 155541121) is 4-(4-methylsulfonylphenyl)-5,5-diphenylpent-4-en-1-ol.
What is the SMILES notation for 4-(4-methylsulfonylphenyl)-5,5-diphenylpent-4-en-1-ol?
The canonical SMILES for 4-(4-methylsulfonylphenyl)-5,5-diphenylpent-4-en-1-ol is CS(=O)(=O)c1ccc(C(CCCO)=C(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 4-(4-methylsulfonylphenyl)-5,5-diphenylpent-4-en-1-ol?
The InChIKey is UTJHBKNMVJTZMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24O3S/c1-28(26,27)22-16-14-19(15-17-22)23(13-8-18-25)24(20-9-4-2-5-10-20)21-11-6-3-7-12-21/h2-7,9-12,14-17,25H,8,13,18H2,1H3.
What are the key properties of 4-(4-methylsulfonylphenyl)-5,5-diphenylpent-4-en-1-ol?
4-(4-methylsulfonylphenyl)-5,5-diphenylpent-4-en-1-ol has a molecular weight of 392.52 g/mol, XLogP of 4.82, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylsulfonylphenyl)-5,5-diphenylpent-4-en-1-ol is sourced from PubChem (CID 155541121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).