C27H31N5O3S2 — CID 155541136
N-[3-[5-(6-ethoxy-3-pyridinyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide (PubChem CID 155541136) has the molecular formula C27H31N5O3S2 and a molecular weight of 537.71 g/mol. Its IUPAC name is N-[3-[5-(6-ethoxy-3-pyridinyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide.
| Compound Name | N-[3-[5-(6-ethoxy-3-pyridinyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide |
|---|---|
| PubChem CID | 155541136 |
| Molecular Formula | C27H31N5O3S2 |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | N-[3-[5-(6-ethoxy-3-pyridinyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide |
| SMILES | CCOc1ccc(-c2ccc3sc(-c4c(NC(=O)CCNCCOC)sc5c4CCNC5)nc3c2)cn1 |
| InChI | InChI=1S/C27H31N5O3S2/c1-3-35-24-7-5-18(15-30-24)17-4-6-21-20(14-17)31-26(36-21)25-19-8-10-29-16-22(19)37-27(25)32-23(33)9-11-28-12-13-34-2/h4-7,14-15,28-29H,3,8-13,16H2,1-2H3,(H,32,33) |
| InChIKey | JFZZUKZUYIICGP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|