C28H38O8 — CID 155541156
[(1S,3R,5R)-1,3-diacetyloxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-10-oxo-3,5,6,6a,8,9-hexahydro-1H-benzo[d][2]benzofuran-5-yl] butanoate (PubChem CID 155541156) has the molecular formula C28H38O8 and a molecular weight of 502.60 g/mol. Its IUPAC name is [(1S,3R,5R)-1,3-diacetyloxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-10-oxo-3,5,6,6a,8,9-hexahydro-1H-benzo[d][2]benzofuran-5-yl] butanoate.
| Compound Name | [(1S,3R,5R)-1,3-diacetyloxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-10-oxo-3,5,6,6a,8,9-hexahydro-1H-benzo[d][2]benzofuran-5-yl] butanoate |
|---|---|
| PubChem CID | 155541156 |
| Molecular Formula | C28H38O8 |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | [(1S,3R,5R)-1,3-diacetyloxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-10-oxo-3,5,6,6a,8,9-hexahydro-1H-benzo[d][2]benzofuran-5-yl] butanoate |
| SMILES | C=CC(=C)CCC1(C)C(C)CC(=O)C23C(=C[C@H](OC(=O)CCC)CC12)[C@@H](OC(C)=O)O[C@H]3OC(C)=O |
| InChI | InChI=1S/C28H38O8/c1-8-10-24(32)35-20-14-21-25(33-18(5)29)36-26(34-19(6)30)28(21)22(15-20)27(7,12-11-16(3)9-2)17(4)13-23(28)31/h9,14,17,20,22,25-26H,2-3,8,10-13,15H2,1,4-7H3/t17?,20-,22?,25-,26+,27?,28?/m0/s1 |
| InChIKey | FNBYOSZOQAZRAW-KWCFWXNCSA-N |
| XLogP | 4.58 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|