C27H30N2O3 — CID 155541189
(4R,5S)-2,4,5-tris(4-ethoxyphenyl)-4,5-dihydro-1H-imidazole (PubChem CID 155541189) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is (4R,5S)-2,4,5-tris(4-ethoxyphenyl)-4,5-dihydro-1H-imidazole.
| Compound Name | (4R,5S)-2,4,5-tris(4-ethoxyphenyl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 155541189 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | (4R,5S)-2,4,5-tris(4-ethoxyphenyl)-4,5-dihydro-1H-imidazole |
| SMILES | CCOc1ccc(C2=N[C@H](c3ccc(OCC)cc3)[C@H](c3ccc(OCC)cc3)N2)cc1 |
| InChI | InChI=1S/C27H30N2O3/c1-4-30-22-13-7-19(8-14-22)25-26(20-9-15-23(16-10-20)31-5-2)29-27(28-25)21-11-17-24(18-12-21)32-6-3/h7-18,25-26H,4-6H2,1-3H3,(H,28,29)/t25-,26+ |
| InChIKey | OTXVMDYWSQMHKU-WMPKNSHKSA-N |
| XLogP | 5.72 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |