C31H38N6O2S2 — CID 155541213
3-(2-methoxyethylamino)-N-[3-[6-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide (PubChem CID 155541213) has the molecular formula C31H38N6O2S2 and a molecular weight of 590.82 g/mol. Its IUPAC name is 3-(2-methoxyethylamino)-N-[3-[6-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide.
| Compound Name | 3-(2-methoxyethylamino)-N-[3-[6-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide |
|---|---|
| PubChem CID | 155541213 |
| Molecular Formula | C31H38N6O2S2 |
| Molecular Weight | 590.82 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | 3-(2-methoxyethylamino)-N-[3-[6-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide |
| SMILES | COCCNCCC(=O)Nc1sc2c(c1-c1nc3ccc(-c4ccc(N5CCN(C)CC5)cc4)cc3s1)CCNC2 |
| InChI | InChI=1S/C31H38N6O2S2/c1-36-14-16-37(17-15-36)23-6-3-21(4-7-23)22-5-8-25-26(19-22)40-30(34-25)29-24-9-11-33-20-27(24)41-31(29)35-28(38)10-12-32-13-18-39-2/h3-8,19,32-33H,9-18,20H2,1-2H3,(H,35,38) |
| InChIKey | HTDMKQPAZSFFDB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.82 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|