About [4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]phenyl]methanamine
[4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]phenyl]methanamine (PubChem CID 155541368) has the molecular formula C18H18FN3
and a molecular weight of 295.36 g/mol. Its IUPAC name is [4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]phenyl]methanamine.
Molecular Properties
| Compound Name | [4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]phenyl]methanamine |
| PubChem CID | 155541368 |
| Molecular Formula | C18H18FN3 |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | [4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]phenyl]methanamine |
| SMILES | Cc1nn(-c2ccc(CN)cc2)c(C)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H18FN3/c1-12-18(15-5-7-16(19)8-6-15)13(2)22(21-12)17-9-3-14(11-20)4-10-17/h3-10H,11,20H2,1-2H3 |
| InChIKey | BBLWVUFVBPWMEM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]phenyl]methanamine?
The IUPAC name of [4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]phenyl]methanamine (CID 155541368) is [4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]phenyl]methanamine.
What is the SMILES notation for [4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]phenyl]methanamine?
The canonical SMILES for [4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]phenyl]methanamine is Cc1nn(-c2ccc(CN)cc2)c(C)c1-c1ccc(F)cc1.
What is the InChIKey of [4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]phenyl]methanamine?
The InChIKey is BBLWVUFVBPWMEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18FN3/c1-12-18(15-5-7-16(19)8-6-15)13(2)22(21-12)17-9-3-14(11-20)4-10-17/h3-10H,11,20H2,1-2H3.
What are the key properties of [4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]phenyl]methanamine?
[4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]phenyl]methanamine has a molecular weight of 295.36 g/mol, XLogP of 3.75, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]phenyl]methanamine is sourced from PubChem (CID 155541368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).