About [4-chloro-2-[(4-fluorophenyl)carbamoyl]phenyl] N-(1-adamantyl)carbamate
[4-chloro-2-[(4-fluorophenyl)carbamoyl]phenyl] N-(1-adamantyl)carbamate (PubChem CID 155541375) has the molecular formula C24H24ClFN2O3
and a molecular weight of 442.92 g/mol. Its IUPAC name is [4-chloro-2-[(4-fluorophenyl)carbamoyl]phenyl] N-(1-adamantyl)carbamate.
Molecular Properties
| Compound Name | [4-chloro-2-[(4-fluorophenyl)carbamoyl]phenyl] N-(1-adamantyl)carbamate |
| PubChem CID | 155541375 |
| Molecular Formula | C24H24ClFN2O3 |
| Molecular Weight | 442.92 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | [4-chloro-2-[(4-fluorophenyl)carbamoyl]phenyl] N-(1-adamantyl)carbamate |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)Oc1ccc(Cl)cc1C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H24ClFN2O3/c25-17-1-6-21(20(10-17)22(29)27-19-4-2-18(26)3-5-19)31-23(30)28-24-11-14-7-15(12-24)9-16(8-14)13-24/h1-6,10,14-16H,7-9,11-13H2,(H,27,29)(H,28,30) |
| InChIKey | RDVBOBZIWATPFQ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.92 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-chloro-2-[(4-fluorophenyl)carbamoyl]phenyl] N-(1-adamantyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-chloro-2-[(4-fluorophenyl)carbamoyl]phenyl] N-(1-adamantyl)carbamate?
The IUPAC name of [4-chloro-2-[(4-fluorophenyl)carbamoyl]phenyl] N-(1-adamantyl)carbamate (CID 155541375) is [4-chloro-2-[(4-fluorophenyl)carbamoyl]phenyl] N-(1-adamantyl)carbamate.
What is the SMILES notation for [4-chloro-2-[(4-fluorophenyl)carbamoyl]phenyl] N-(1-adamantyl)carbamate?
The canonical SMILES for [4-chloro-2-[(4-fluorophenyl)carbamoyl]phenyl] N-(1-adamantyl)carbamate is O=C(NC12CC3CC(CC(C3)C1)C2)Oc1ccc(Cl)cc1C(=O)Nc1ccc(F)cc1.
What is the InChIKey of [4-chloro-2-[(4-fluorophenyl)carbamoyl]phenyl] N-(1-adamantyl)carbamate?
The InChIKey is RDVBOBZIWATPFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24ClFN2O3/c25-17-1-6-21(20(10-17)22(29)27-19-4-2-18(26)3-5-19)31-23(30)28-24-11-14-7-15(12-24)9-16(8-14)13-24/h1-6,10,14-16H,7-9,11-13H2,(H,27,29)(H,28,30).
What are the key properties of [4-chloro-2-[(4-fluorophenyl)carbamoyl]phenyl] N-(1-adamantyl)carbamate?
[4-chloro-2-[(4-fluorophenyl)carbamoyl]phenyl] N-(1-adamantyl)carbamate has a molecular weight of 442.92 g/mol, XLogP of 5.79, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-chloro-2-[(4-fluorophenyl)carbamoyl]phenyl] N-(1-adamantyl)carbamate is sourced from PubChem (CID 155541375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).