C26H23N7O3 — CID 155541386
N-[(E)-benzylideneamino]-4-[1-[2-[(2E)-2-benzylidenehydrazinyl]-2-oxoethyl]-3-methyl-5-oxo-1,2,4-triazol-4-yl]benzamide (PubChem CID 155541386) has the molecular formula C26H23N7O3 and a molecular weight of 481.52 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-4-[1-[2-[(2E)-2-benzylidenehydrazinyl]-2-oxoethyl]-3-methyl-5-oxo-1,2,4-triazol-4-yl]benzamide.
| Compound Name | N-[(E)-benzylideneamino]-4-[1-[2-[(2E)-2-benzylidenehydrazinyl]-2-oxoethyl]-3-methyl-5-oxo-1,2,4-triazol-4-yl]benzamide |
|---|---|
| PubChem CID | 155541386 |
| Molecular Formula | C26H23N7O3 |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | N-[(E)-benzylideneamino]-4-[1-[2-[(2E)-2-benzylidenehydrazinyl]-2-oxoethyl]-3-methyl-5-oxo-1,2,4-triazol-4-yl]benzamide |
| SMILES | Cc1nn(CC(=O)N/N=C/c2ccccc2)c(=O)n1-c1ccc(C(=O)N/N=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C26H23N7O3/c1-19-31-32(18-24(34)29-27-16-20-8-4-2-5-9-20)26(36)33(19)23-14-12-22(13-15-23)25(35)30-28-17-21-10-6-3-7-11-21/h2-17H,18H2,1H3,(H,29,34)(H,30,35)/b27-16+,28-17+ |
| InChIKey | UUXGUHRRRWGLJM-ODBZBXGJSA-N |
| XLogP | 2.26 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|