C27H31N5O2S2 — CID 155541399
N-[(5R,7S)-5,7-dimethyl-3-(6-pyridin-3-yl-1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide (PubChem CID 155541399) has the molecular formula C27H31N5O2S2 and a molecular weight of 521.71 g/mol. Its IUPAC name is N-[(5R,7S)-5,7-dimethyl-3-(6-pyridin-3-yl-1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide.
| Compound Name | N-[(5R,7S)-5,7-dimethyl-3-(6-pyridin-3-yl-1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide |
|---|---|
| PubChem CID | 155541399 |
| Molecular Formula | C27H31N5O2S2 |
| Molecular Weight | 521.71 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | N-[(5R,7S)-5,7-dimethyl-3-(6-pyridin-3-yl-1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide |
| SMILES | COCCNCCC(=O)Nc1sc2c(c1-c1nc3ccc(-c4cccnc4)cc3s1)C[C@@H](C)N[C@H]2C |
| InChI | InChI=1S/C27H31N5O2S2/c1-16-13-20-24(26-31-21-7-6-18(14-22(21)35-26)19-5-4-9-29-15-19)27(36-25(20)17(2)30-16)32-23(33)8-10-28-11-12-34-3/h4-7,9,14-17,28,30H,8,10-13H2,1-3H3,(H,32,33)/t16-,17+/m1/s1 |
| InChIKey | YNHCXCDCYAPERJ-SJORKVTESA-N |
| XLogP | 5.25 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.71 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|