C13H15ClFN7O4S — CID 155541446
N'-(3-chloro-4-fluorophenyl)-4-[2-(1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 155541446) has the molecular formula C13H15ClFN7O4S and a molecular weight of 419.83 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-4-[2-(1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-4-[2-(1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 155541446 |
| Molecular Formula | C13H15ClFN7O4S |
| Molecular Weight | 419.83 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-4-[2-(1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | O=S1(=O)NCCN1CCNc1nonc1/C(=N/c1ccc(F)c(Cl)c1)NO |
| InChI | InChI=1S/C13H15ClFN7O4S/c14-9-7-8(1-2-10(9)15)18-13(19-23)11-12(21-26-20-11)16-3-5-22-6-4-17-27(22,24)25/h1-2,7,17,23H,3-6H2,(H,16,21)(H,18,19) |
| InChIKey | QFGOSPSPEACKJE-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 144.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.83 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|