C17H15N5O5S — CID 155541462
3-(3,5-dinitrophenyl)-5-[(4-methoxyphenyl)methylsulfanyl]-4-methyl-1,2,4-triazole (PubChem CID 155541462) has the molecular formula C17H15N5O5S and a molecular weight of 401.40 g/mol. Its IUPAC name is 3-(3,5-dinitrophenyl)-5-[(4-methoxyphenyl)methylsulfanyl]-4-methyl-1,2,4-triazole.
| Compound Name | 3-(3,5-dinitrophenyl)-5-[(4-methoxyphenyl)methylsulfanyl]-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 155541462 |
| Molecular Formula | C17H15N5O5S |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 3-(3,5-dinitrophenyl)-5-[(4-methoxyphenyl)methylsulfanyl]-4-methyl-1,2,4-triazole |
| SMILES | COc1ccc(CSc2nnc(-c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)n2C)cc1 |
| InChI | InChI=1S/C17H15N5O5S/c1-20-16(12-7-13(21(23)24)9-14(8-12)22(25)26)18-19-17(20)28-10-11-3-5-15(27-2)6-4-11/h3-9H,10H2,1-2H3 |
| InChIKey | CURHVYMNXLOUPD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 126.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|