About 2-[(E)-2-(5-bromo-1,3-benzodioxol-4-yl)ethenyl]-3H-quinazolin-4-one
2-[(E)-2-(5-bromo-1,3-benzodioxol-4-yl)ethenyl]-3H-quinazolin-4-one (PubChem CID 155541513) has the molecular formula C17H11BrN2O3
and a molecular weight of 371.19 g/mol. Its IUPAC name is 2-[(E)-2-(5-bromo-1,3-benzodioxol-4-yl)ethenyl]-3H-quinazolin-4-one.
Molecular Properties
| Compound Name | 2-[(E)-2-(5-bromo-1,3-benzodioxol-4-yl)ethenyl]-3H-quinazolin-4-one |
| PubChem CID | 155541513 |
| Molecular Formula | C17H11BrN2O3 |
| Molecular Weight | 371.19 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 2-[(E)-2-(5-bromo-1,3-benzodioxol-4-yl)ethenyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(/C=C/c2c(Br)ccc3c2OCO3)nc2ccccc12 |
| InChI | InChI=1S/C17H11BrN2O3/c18-12-6-7-14-16(23-9-22-14)10(12)5-8-15-19-13-4-2-1-3-11(13)17(21)20-15/h1-8H,9H2,(H,19,20,21)/b8-5+ |
| InChIKey | QHLAKGGTGCEFLI-VMPITWQZSA-N |
| XLogP | 3.58 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.19 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(E)-2-(5-bromo-1,3-benzodioxol-4-yl)ethenyl]-3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-(5-bromo-1,3-benzodioxol-4-yl)ethenyl]-3H-quinazolin-4-one?
The IUPAC name of 2-[(E)-2-(5-bromo-1,3-benzodioxol-4-yl)ethenyl]-3H-quinazolin-4-one (CID 155541513) is 2-[(E)-2-(5-bromo-1,3-benzodioxol-4-yl)ethenyl]-3H-quinazolin-4-one.
What is the SMILES notation for 2-[(E)-2-(5-bromo-1,3-benzodioxol-4-yl)ethenyl]-3H-quinazolin-4-one?
The canonical SMILES for 2-[(E)-2-(5-bromo-1,3-benzodioxol-4-yl)ethenyl]-3H-quinazolin-4-one is O=c1[nH]c(/C=C/c2c(Br)ccc3c2OCO3)nc2ccccc12.
What is the InChIKey of 2-[(E)-2-(5-bromo-1,3-benzodioxol-4-yl)ethenyl]-3H-quinazolin-4-one?
The InChIKey is QHLAKGGTGCEFLI-VMPITWQZSA-N. The full InChI is InChI=1S/C17H11BrN2O3/c18-12-6-7-14-16(23-9-22-14)10(12)5-8-15-19-13-4-2-1-3-11(13)17(21)20-15/h1-8H,9H2,(H,19,20,21)/b8-5+.
What are the key properties of 2-[(E)-2-(5-bromo-1,3-benzodioxol-4-yl)ethenyl]-3H-quinazolin-4-one?
2-[(E)-2-(5-bromo-1,3-benzodioxol-4-yl)ethenyl]-3H-quinazolin-4-one has a molecular weight of 371.19 g/mol, XLogP of 3.58, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-(5-bromo-1,3-benzodioxol-4-yl)ethenyl]-3H-quinazolin-4-one is sourced from PubChem (CID 155541513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).