C28H26O7 — CID 155541605
[(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] (Z)-4-(2,5-dimethylphenyl)-4-oxobut-2-enoate (PubChem CID 155541605) has the molecular formula C28H26O7 and a molecular weight of 474.51 g/mol. Its IUPAC name is [(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] (Z)-4-(2,5-dimethylphenyl)-4-oxobut-2-enoate.
| Compound Name | [(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] (Z)-4-(2,5-dimethylphenyl)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 155541605 |
| Molecular Formula | C28H26O7 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | [(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] (Z)-4-(2,5-dimethylphenyl)-4-oxobut-2-enoate |
| SMILES | CC(C)=CC[C@@H](OC(=O)/C=C\C(=O)c1cc(C)ccc1C)C1=CC(=O)c2c(O)ccc(O)c2C1=O |
| InChI | InChI=1S/C28H26O7/c1-15(2)5-11-24(19-14-23(32)26-21(30)8-9-22(31)27(26)28(19)34)35-25(33)12-10-20(29)18-13-16(3)6-7-17(18)4/h5-10,12-14,24,30-31H,11H2,1-4H3/b12-10-/t24-/m1/s1 |
| InChIKey | PMLUIUSLTWTRAE-PFQQOQBSSA-N |
| XLogP | 4.73 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|