About 1-thieno[2,3-c]pyridin-5-ylethane-1,2-diol
1-thieno[2,3-c]pyridin-5-ylethane-1,2-diol (PubChem CID 155541633) has the molecular formula C9H9NO2S
and a molecular weight of 195.24 g/mol. Its IUPAC name is 1-thieno[2,3-c]pyridin-5-ylethane-1,2-diol.
Molecular Properties
| Compound Name | 1-thieno[2,3-c]pyridin-5-ylethane-1,2-diol |
| PubChem CID | 155541633 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 1-thieno[2,3-c]pyridin-5-ylethane-1,2-diol |
| SMILES | OCC(O)c1cc2ccsc2cn1 |
| InChI | InChI=1S/C9H9NO2S/c11-5-8(12)7-3-6-1-2-13-9(6)4-10-7/h1-4,8,11-12H,5H2 |
| InChIKey | JCIHBVISWDMUIX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-thieno[2,3-c]pyridin-5-ylethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-thieno[2,3-c]pyridin-5-ylethane-1,2-diol?
The IUPAC name of 1-thieno[2,3-c]pyridin-5-ylethane-1,2-diol (CID 155541633) is 1-thieno[2,3-c]pyridin-5-ylethane-1,2-diol.
What is the SMILES notation for 1-thieno[2,3-c]pyridin-5-ylethane-1,2-diol?
The canonical SMILES for 1-thieno[2,3-c]pyridin-5-ylethane-1,2-diol is OCC(O)c1cc2ccsc2cn1.
What is the InChIKey of 1-thieno[2,3-c]pyridin-5-ylethane-1,2-diol?
The InChIKey is JCIHBVISWDMUIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2S/c11-5-8(12)7-3-6-1-2-13-9(6)4-10-7/h1-4,8,11-12H,5H2.
What are the key properties of 1-thieno[2,3-c]pyridin-5-ylethane-1,2-diol?
1-thieno[2,3-c]pyridin-5-ylethane-1,2-diol has a molecular weight of 195.24 g/mol, XLogP of 1.32, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-thieno[2,3-c]pyridin-5-ylethane-1,2-diol is sourced from PubChem (CID 155541633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).