C21H25N3O2 — CID 155541638
4-[(2S)-2-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]butan-1-ol (PubChem CID 155541638) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-[(2S)-2-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]butan-1-ol.
| Compound Name | 4-[(2S)-2-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]butan-1-ol |
|---|---|
| PubChem CID | 155541638 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 4-[(2S)-2-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]butan-1-ol |
| SMILES | OCCCCN1CCCC[C@H]1c1nc(-c2ccc3ccccc3c2)no1 |
| InChI | InChI=1S/C21H25N3O2/c25-14-6-5-13-24-12-4-3-9-19(24)21-22-20(23-26-21)18-11-10-16-7-1-2-8-17(16)15-18/h1-2,7-8,10-11,15,19,25H,3-6,9,12-14H2/t19-/m0/s1 |
| InChIKey | DPYAMLRMBWSHCC-IBGZPJMESA-N |
| XLogP | 4.19 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|