C29H35N3O3 — CID 155541830
N-[[(4aR,8aR)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyran-4a-yl]methyl]-3-[2-amino-6-(2-methylphenyl)quinolin-3-yl]-2-methylpropanamide (PubChem CID 155541830) has the molecular formula C29H35N3O3 and a molecular weight of 473.62 g/mol. Its IUPAC name is N-[[(4aR,8aR)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyran-4a-yl]methyl]-3-[2-amino-6-(2-methylphenyl)quinolin-3-yl]-2-methylpropanamide.
| Compound Name | N-[[(4aR,8aR)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyran-4a-yl]methyl]-3-[2-amino-6-(2-methylphenyl)quinolin-3-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 155541830 |
| Molecular Formula | C29H35N3O3 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | N-[[(4aR,8aR)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyran-4a-yl]methyl]-3-[2-amino-6-(2-methylphenyl)quinolin-3-yl]-2-methylpropanamide |
| SMILES | Cc1ccccc1-c1ccc2nc(N)c(CC(C)C(=O)NC[C@@]34CCCO[C@@H]3CCOC4)cc2c1 |
| InChI | InChI=1S/C29H35N3O3/c1-19-6-3-4-7-24(19)21-8-9-25-22(15-21)16-23(27(30)32-25)14-20(2)28(33)31-17-29-11-5-12-35-26(29)10-13-34-18-29/h3-4,6-9,15-16,20,26H,5,10-14,17-18H2,1-2H3,(H2,30,32)(H,31,33)/t20?,26-,29-/m1/s1 |
| InChIKey | FQGNBTCHQHIBJD-CGYDBHIHSA-N |
| XLogP | 4.67 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |