C24H45N3O3 — CID 155541850
3-imidazol-1-yl-N-[[(3S,4S)-3,6,6-tributyl-3-methoxydioxan-4-yl]methyl]propan-1-amine (PubChem CID 155541850) has the molecular formula C24H45N3O3 and a molecular weight of 423.64 g/mol. Its IUPAC name is 3-imidazol-1-yl-N-[[(3S,4S)-3,6,6-tributyl-3-methoxydioxan-4-yl]methyl]propan-1-amine.
| Compound Name | 3-imidazol-1-yl-N-[[(3S,4S)-3,6,6-tributyl-3-methoxydioxan-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 155541850 |
| Molecular Formula | C24H45N3O3 |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 423.35 |
| IUPAC Name | 3-imidazol-1-yl-N-[[(3S,4S)-3,6,6-tributyl-3-methoxydioxan-4-yl]methyl]propan-1-amine |
| SMILES | CCCCC1(CCCC)C[C@@H](CNCCCn2ccnc2)[C@@](CCCC)(OC)OO1 |
| InChI | InChI=1S/C24H45N3O3/c1-5-8-12-23(13-9-6-2)19-22(24(28-4,30-29-23)14-10-7-3)20-25-15-11-17-27-18-16-26-21-27/h16,18,21-22,25H,5-15,17,19-20H2,1-4H3/t22-,24-/m0/s1 |
| InChIKey | RQPJDJQFQJTRSF-UPVQGACJSA-N |
| XLogP | 5.48 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|