About (2S)-2-amino-N-[[4-(3,5-dichlorophenoxy)phenyl]methyl]propanamide;hydrochloride
(2S)-2-amino-N-[[4-(3,5-dichlorophenoxy)phenyl]methyl]propanamide;hydrochloride (PubChem CID 155541904) has the molecular formula C16H17Cl3N2O2
and a molecular weight of 375.68 g/mol. Its IUPAC name is (2S)-2-amino-N-[[4-(3,5-dichlorophenoxy)phenyl]methyl]propanamide;hydrochloride.
Molecular Properties
| Compound Name | (2S)-2-amino-N-[[4-(3,5-dichlorophenoxy)phenyl]methyl]propanamide;hydrochloride |
| PubChem CID | 155541904 |
| Molecular Formula | C16H17Cl3N2O2 |
| Molecular Weight | 375.68 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | (2S)-2-amino-N-[[4-(3,5-dichlorophenoxy)phenyl]methyl]propanamide;hydrochloride |
| SMILES | C[C@H](N)C(=O)NCc1ccc(Oc2cc(Cl)cc(Cl)c2)cc1.Cl |
| InChI | InChI=1S/C16H16Cl2N2O2.ClH/c1-10(19)16(21)20-9-11-2-4-14(5-3-11)22-15-7-12(17)6-13(18)8-15;/h2-8,10H,9,19H2,1H3,(H,20,21);1H/t10-;/m0./s1 |
| InChIKey | ZOBVXCPBHIZKSK-PPHPATTJSA-N |
| XLogP | 4.17 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.68 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-amino-N-[[4-(3,5-dichlorophenoxy)phenyl]methyl]propanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-N-[[4-(3,5-dichlorophenoxy)phenyl]methyl]propanamide;hydrochloride?
The IUPAC name of (2S)-2-amino-N-[[4-(3,5-dichlorophenoxy)phenyl]methyl]propanamide;hydrochloride (CID 155541904) is (2S)-2-amino-N-[[4-(3,5-dichlorophenoxy)phenyl]methyl]propanamide;hydrochloride.
What is the SMILES notation for (2S)-2-amino-N-[[4-(3,5-dichlorophenoxy)phenyl]methyl]propanamide;hydrochloride?
The canonical SMILES for (2S)-2-amino-N-[[4-(3,5-dichlorophenoxy)phenyl]methyl]propanamide;hydrochloride is C[C@H](N)C(=O)NCc1ccc(Oc2cc(Cl)cc(Cl)c2)cc1.Cl.
What is the InChIKey of (2S)-2-amino-N-[[4-(3,5-dichlorophenoxy)phenyl]methyl]propanamide;hydrochloride?
The InChIKey is ZOBVXCPBHIZKSK-PPHPATTJSA-N. The full InChI is InChI=1S/C16H16Cl2N2O2.ClH/c1-10(19)16(21)20-9-11-2-4-14(5-3-11)22-15-7-12(17)6-13(18)8-15;/h2-8,10H,9,19H2,1H3,(H,20,21);1H/t10-;/m0./s1.
What are the key properties of (2S)-2-amino-N-[[4-(3,5-dichlorophenoxy)phenyl]methyl]propanamide;hydrochloride?
(2S)-2-amino-N-[[4-(3,5-dichlorophenoxy)phenyl]methyl]propanamide;hydrochloride has a molecular weight of 375.68 g/mol, XLogP of 4.17, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-N-[[4-(3,5-dichlorophenoxy)phenyl]methyl]propanamide;hydrochloride is sourced from PubChem (CID 155541904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).