C20H34O7 — CID 155542039
(1S,2R,3S,3aS,4R,5R,6E,9R,11R,12E,13aS)-2,5,8,8,12-pentamethyl-1,2,3,4,9,10,11,13a-octahydrocyclopenta[12]annulene-1,3,3a,4,5,9,11-heptol (PubChem CID 155542039) has the molecular formula C20H34O7 and a molecular weight of 386.49 g/mol. Its IUPAC name is (1S,2R,3S,3aS,4R,5R,6E,9R,11R,12E,13aS)-2,5,8,8,12-pentamethyl-1,2,3,4,9,10,11,13a-octahydrocyclopenta[12]annulene-1,3,3a,4,5,9,11-heptol.
| Compound Name | (1S,2R,3S,3aS,4R,5R,6E,9R,11R,12E,13aS)-2,5,8,8,12-pentamethyl-1,2,3,4,9,10,11,13a-octahydrocyclopenta[12]annulene-1,3,3a,4,5,9,11-heptol |
|---|---|
| PubChem CID | 155542039 |
| Molecular Formula | C20H34O7 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | (1S,2R,3S,3aS,4R,5R,6E,9R,11R,12E,13aS)-2,5,8,8,12-pentamethyl-1,2,3,4,9,10,11,13a-octahydrocyclopenta[12]annulene-1,3,3a,4,5,9,11-heptol |
| SMILES | C/C1=C\[C@H]2[C@@H](O)[C@@H](C)[C@H](O)[C@]2(O)[C@H](O)[C@](C)(O)/C=C/C(C)(C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H34O7/c1-10-8-12-15(23)11(2)16(24)20(12,27)17(25)19(5,26)7-6-18(3,4)14(22)9-13(10)21/h6-8,11-17,21-27H,9H2,1-5H3/b7-6+,10-8+/t11-,12+,13-,14-,15+,16+,17-,19-,20+/m1/s1 |
| InChIKey | XDLGAHOBPNQUGY-WMGBMMCRSA-N |
| XLogP | -0.53 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|