C27H43N3O3 — CID 155542107
3-[(1S,5R)-8-[5-[2-ethylbutyl-(2-hydroxyacetyl)amino]pentyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide (PubChem CID 155542107) has the molecular formula C27H43N3O3 and a molecular weight of 457.66 g/mol. Its IUPAC name is 3-[(1S,5R)-8-[5-[2-ethylbutyl-(2-hydroxyacetyl)amino]pentyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide.
| Compound Name | 3-[(1S,5R)-8-[5-[2-ethylbutyl-(2-hydroxyacetyl)amino]pentyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide |
|---|---|
| PubChem CID | 155542107 |
| Molecular Formula | C27H43N3O3 |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.33 |
| IUPAC Name | 3-[(1S,5R)-8-[5-[2-ethylbutyl-(2-hydroxyacetyl)amino]pentyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide |
| SMILES | CCC(CC)CN(CCCCCN1[C@@H]2CC[C@H]1CC(c1cccc(C(N)=O)c1)C2)C(=O)CO |
| InChI | InChI=1S/C27H43N3O3/c1-3-20(4-2)18-29(26(32)19-31)13-6-5-7-14-30-24-11-12-25(30)17-23(16-24)21-9-8-10-22(15-21)27(28)33/h8-10,15,20,23-25,31H,3-7,11-14,16-19H2,1-2H3,(H2,28,33)/t23?,24-,25+ |
| InChIKey | BAJJIHKMLNYVEG-QILAJZQNSA-N |
| XLogP | 3.92 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|