C27H31N3O2 — CID 155542202
1-[(4aR,8aR)-4a-benzyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-3-(2-aminoquinolin-3-yl)propan-1-one (PubChem CID 155542202) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 1-[(4aR,8aR)-4a-benzyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-3-(2-aminoquinolin-3-yl)propan-1-one.
| Compound Name | 1-[(4aR,8aR)-4a-benzyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-3-(2-aminoquinolin-3-yl)propan-1-one |
|---|---|
| PubChem CID | 155542202 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 1-[(4aR,8aR)-4a-benzyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-3-(2-aminoquinolin-3-yl)propan-1-one |
| SMILES | Nc1nc2ccccc2cc1CCC(=O)N1CC[C@H]2OCCC[C@@]2(Cc2ccccc2)C1 |
| InChI | InChI=1S/C27H31N3O2/c28-26-22(17-21-9-4-5-10-23(21)29-26)11-12-25(31)30-15-13-24-27(19-30,14-6-16-32-24)18-20-7-2-1-3-8-20/h1-5,7-10,17,24H,6,11-16,18-19H2,(H2,28,29)/t24-,27-/m1/s1 |
| InChIKey | DOXJATPTBCTYCX-SHQCIBLASA-N |
| XLogP | 4.39 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |