C28H21N5O4S — CID 155542252
2-(4-methoxyphenyl)-5-methyl-4-[4-(2-oxochromen-3-yl)-2-phenylimino-1,3-thiazol-3-yl]-1,2,4-triazol-3-one (PubChem CID 155542252) has the molecular formula C28H21N5O4S and a molecular weight of 523.57 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-5-methyl-4-[4-(2-oxochromen-3-yl)-2-phenylimino-1,3-thiazol-3-yl]-1,2,4-triazol-3-one.
| Compound Name | 2-(4-methoxyphenyl)-5-methyl-4-[4-(2-oxochromen-3-yl)-2-phenylimino-1,3-thiazol-3-yl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 155542252 |
| Molecular Formula | C28H21N5O4S |
| Molecular Weight | 523.57 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | 2-(4-methoxyphenyl)-5-methyl-4-[4-(2-oxochromen-3-yl)-2-phenylimino-1,3-thiazol-3-yl]-1,2,4-triazol-3-one |
| SMILES | COc1ccc(-n2nc(C)n(-n3c(-c4cc5ccccc5oc4=O)cs/c3=N\c3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C28H21N5O4S/c1-18-30-31(21-12-14-22(36-2)15-13-21)28(35)32(18)33-24(17-38-27(33)29-20-9-4-3-5-10-20)23-16-19-8-6-7-11-25(19)37-26(23)34/h3-17H,1-2H3/b29-27- |
| InChIKey | HDLGRLNUKHYERH-OHYPFYFLSA-N |
| XLogP | 4.53 |
| TPSA | 96.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|