C13H19NO2 — CID 155542296
(2R,3R,4R,5R)-1,2-dimethyl-5-(4-methylphenyl)pyrrolidine-3,4-diol (PubChem CID 155542296) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (2R,3R,4R,5R)-1,2-dimethyl-5-(4-methylphenyl)pyrrolidine-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-1,2-dimethyl-5-(4-methylphenyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 155542296 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (2R,3R,4R,5R)-1,2-dimethyl-5-(4-methylphenyl)pyrrolidine-3,4-diol |
| SMILES | Cc1ccc([C@@H]2[C@@H](O)[C@H](O)[C@@H](C)N2C)cc1 |
| InChI | InChI=1S/C13H19NO2/c1-8-4-6-10(7-5-8)11-13(16)12(15)9(2)14(11)3/h4-7,9,11-13,15-16H,1-3H3/t9-,11-,12-,13-/m1/s1 |
| InChIKey | NZBQFJZZPNJETE-OJAKKHQRSA-N |
| XLogP | 1.09 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |