C24H27F3N4S — CID 155542351
N-[4-[[[(1R,2S)-2-phenylcyclopropyl]amino]methyl]cyclohexyl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 155542351) has the molecular formula C24H27F3N4S and a molecular weight of 460.57 g/mol. Its IUPAC name is N-[4-[[[(1R,2S)-2-phenylcyclopropyl]amino]methyl]cyclohexyl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[4-[[[(1R,2S)-2-phenylcyclopropyl]amino]methyl]cyclohexyl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155542351 |
| Molecular Formula | C24H27F3N4S |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | N-[4-[[[(1R,2S)-2-phenylcyclopropyl]amino]methyl]cyclohexyl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | FC(F)(F)Cc1cc2c(NC3CCC(CN[C@@H]4C[C@H]4c4ccccc4)CC3)ncnc2s1 |
| InChI | InChI=1S/C24H27F3N4S/c25-24(26,27)12-18-10-20-22(29-14-30-23(20)32-18)31-17-8-6-15(7-9-17)13-28-21-11-19(21)16-4-2-1-3-5-16/h1-5,10,14-15,17,19,21,28H,6-9,11-13H2,(H,29,30,31)/t15?,17?,19-,21+/m0/s1 |
| InChIKey | BWWSOKMEUMJPCJ-KZEUKAMHSA-N |
| XLogP | 5.91 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |