C16H19N5O3 — CID 155542513
methyl 3-(2-methoxyethylamino)-2-(2-methyl-1H-imidazol-5-yl)imidazo[1,2-a]pyridine-6-carboxylate (PubChem CID 155542513) has the molecular formula C16H19N5O3 and a molecular weight of 329.36 g/mol. Its IUPAC name is methyl 3-(2-methoxyethylamino)-2-(2-methyl-1H-imidazol-5-yl)imidazo[1,2-a]pyridine-6-carboxylate.
| Compound Name | methyl 3-(2-methoxyethylamino)-2-(2-methyl-1H-imidazol-5-yl)imidazo[1,2-a]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 155542513 |
| Molecular Formula | C16H19N5O3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | methyl 3-(2-methoxyethylamino)-2-(2-methyl-1H-imidazol-5-yl)imidazo[1,2-a]pyridine-6-carboxylate |
| SMILES | COCCNc1c(-c2cnc(C)[nH]2)nc2ccc(C(=O)OC)cn12 |
| InChI | InChI=1S/C16H19N5O3/c1-10-18-8-12(19-10)14-15(17-6-7-23-2)21-9-11(16(22)24-3)4-5-13(21)20-14/h4-5,8-9,17H,6-7H2,1-3H3,(H,18,19) |
| InChIKey | TUIVITPWBCEVFY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|