C21H21ClF2N2O3 — CID 155542565
1-[2-[(E)-[2-(2,4-difluorophenyl)phenyl]methylideneamino]oxyethyl]-3,6-dihydro-2H-pyridine-5-carboxylic acid;hydrochloride (PubChem CID 155542565) has the molecular formula C21H21ClF2N2O3 and a molecular weight of 422.86 g/mol. Its IUPAC name is 1-[2-[(E)-[2-(2,4-difluorophenyl)phenyl]methylideneamino]oxyethyl]-3,6-dihydro-2H-pyridine-5-carboxylic acid;hydrochloride.
| Compound Name | 1-[2-[(E)-[2-(2,4-difluorophenyl)phenyl]methylideneamino]oxyethyl]-3,6-dihydro-2H-pyridine-5-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 155542565 |
| Molecular Formula | C21H21ClF2N2O3 |
| Molecular Weight | 422.86 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 1-[2-[(E)-[2-(2,4-difluorophenyl)phenyl]methylideneamino]oxyethyl]-3,6-dihydro-2H-pyridine-5-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)C1=CCCN(CCO/N=C/c2ccccc2-c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C21H20F2N2O3.ClH/c22-17-7-8-19(20(23)12-17)18-6-2-1-4-15(18)13-24-28-11-10-25-9-3-5-16(14-25)21(26)27;/h1-2,4-8,12-13H,3,9-11,14H2,(H,26,27);1H/b24-13+; |
| InChIKey | UGWDVUZKUKDEJF-KEJAMGHHSA-N |
| XLogP | 4.12 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.86 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|