C13H25N3O5S — CID 155542730
3-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-dimethylazaniumyl]propane-1-sulfonate (PubChem CID 155542730) has the molecular formula C13H25N3O5S and a molecular weight of 335.43 g/mol. Its IUPAC name is 3-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-dimethylazaniumyl]propane-1-sulfonate.
| Compound Name | 3-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-dimethylazaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 155542730 |
| Molecular Formula | C13H25N3O5S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 3-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-dimethylazaniumyl]propane-1-sulfonate |
| SMILES | CC1(C)NC(=O)N(CCC[N+](C)(C)CCCS(=O)(=O)[O-])C1=O |
| InChI | InChI=1S/C13H25N3O5S/c1-13(2)11(17)15(12(18)14-13)7-5-8-16(3,4)9-6-10-22(19,20)21/h5-10H2,1-4H3,(H-,14,18,19,20,21) |
| InChIKey | BXDRZNVNYZPHAM-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|