C17H17FN4OS — CID 155542746
N-(4-fluoro-2-methoxyphenyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine (PubChem CID 155542746) has the molecular formula C17H17FN4OS and a molecular weight of 344.42 g/mol. Its IUPAC name is N-(4-fluoro-2-methoxyphenyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | N-(4-fluoro-2-methoxyphenyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 155542746 |
| Molecular Formula | C17H17FN4OS |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | N-(4-fluoro-2-methoxyphenyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
| SMILES | COc1cc(F)ccc1Nc1ncnc2sc3c(c12)CCN(C)C3 |
| InChI | InChI=1S/C17H17FN4OS/c1-22-6-5-11-14(8-22)24-17-15(11)16(19-9-20-17)21-12-4-3-10(18)7-13(12)23-2/h3-4,7,9H,5-6,8H2,1-2H3,(H,19,20,21) |
| InChIKey | WXJHHZUCAOQHEW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |