About N-[(5S)-6-amino-5-[(2-hydroxybenzoyl)amino]hexyl]-2,3-dihydroxybenzamide
N-[(5S)-6-amino-5-[(2-hydroxybenzoyl)amino]hexyl]-2,3-dihydroxybenzamide (PubChem CID 155542837) has the molecular formula C20H25N3O5
and a molecular weight of 387.44 g/mol. Its IUPAC name is N-[(5S)-6-amino-5-[(2-hydroxybenzoyl)amino]hexyl]-2,3-dihydroxybenzamide.
Molecular Properties
| Compound Name | N-[(5S)-6-amino-5-[(2-hydroxybenzoyl)amino]hexyl]-2,3-dihydroxybenzamide |
| PubChem CID | 155542837 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N-[(5S)-6-amino-5-[(2-hydroxybenzoyl)amino]hexyl]-2,3-dihydroxybenzamide |
| SMILES | NC[C@H](CCCCNC(=O)c1cccc(O)c1O)NC(=O)c1ccccc1O |
| InChI | InChI=1S/C20H25N3O5/c21-12-13(23-20(28)14-7-1-2-9-16(14)24)6-3-4-11-22-19(27)15-8-5-10-17(25)18(15)26/h1-2,5,7-10,13,24-26H,3-4,6,11-12,21H2,(H,22,27)(H,23,28)/t13-/m0/s1 |
| InChIKey | PYWJNFUXMHHARX-ZDUSSCGKSA-N |
| XLogP | 1.46 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze N-[(5S)-6-amino-5-[(2-hydroxybenzoyl)amino]hexyl]-2,3-dihydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5S)-6-amino-5-[(2-hydroxybenzoyl)amino]hexyl]-2,3-dihydroxybenzamide?
The IUPAC name of N-[(5S)-6-amino-5-[(2-hydroxybenzoyl)amino]hexyl]-2,3-dihydroxybenzamide (CID 155542837) is N-[(5S)-6-amino-5-[(2-hydroxybenzoyl)amino]hexyl]-2,3-dihydroxybenzamide.
What is the SMILES notation for N-[(5S)-6-amino-5-[(2-hydroxybenzoyl)amino]hexyl]-2,3-dihydroxybenzamide?
The canonical SMILES for N-[(5S)-6-amino-5-[(2-hydroxybenzoyl)amino]hexyl]-2,3-dihydroxybenzamide is NC[C@H](CCCCNC(=O)c1cccc(O)c1O)NC(=O)c1ccccc1O.
What is the InChIKey of N-[(5S)-6-amino-5-[(2-hydroxybenzoyl)amino]hexyl]-2,3-dihydroxybenzamide?
The InChIKey is PYWJNFUXMHHARX-ZDUSSCGKSA-N. The full InChI is InChI=1S/C20H25N3O5/c21-12-13(23-20(28)14-7-1-2-9-16(14)24)6-3-4-11-22-19(27)15-8-5-10-17(25)18(15)26/h1-2,5,7-10,13,24-26H,3-4,6,11-12,21H2,(H,22,27)(H,23,28)/t13-/m0/s1.
What are the key properties of N-[(5S)-6-amino-5-[(2-hydroxybenzoyl)amino]hexyl]-2,3-dihydroxybenzamide?
N-[(5S)-6-amino-5-[(2-hydroxybenzoyl)amino]hexyl]-2,3-dihydroxybenzamide has a molecular weight of 387.44 g/mol, XLogP of 1.46, 9 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5S)-6-amino-5-[(2-hydroxybenzoyl)amino]hexyl]-2,3-dihydroxybenzamide is sourced from PubChem (CID 155542837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).