About N-[[5,6-bis[4-(furan-3-yl)phenyl]pyrazin-2-yl]methyl]-1-piperidin-4-ylmethanamine
N-[[5,6-bis[4-(furan-3-yl)phenyl]pyrazin-2-yl]methyl]-1-piperidin-4-ylmethanamine (PubChem CID 155542846) has the molecular formula C31H30N4O2
and a molecular weight of 490.61 g/mol. Its IUPAC name is N-[[5,6-bis[4-(furan-3-yl)phenyl]pyrazin-2-yl]methyl]-1-piperidin-4-ylmethanamine.
Molecular Properties
| Compound Name | N-[[5,6-bis[4-(furan-3-yl)phenyl]pyrazin-2-yl]methyl]-1-piperidin-4-ylmethanamine |
| PubChem CID | 155542846 |
| Molecular Formula | C31H30N4O2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | N-[[5,6-bis[4-(furan-3-yl)phenyl]pyrazin-2-yl]methyl]-1-piperidin-4-ylmethanamine |
| SMILES | c1cc(-c2ccc(-c3ncc(CNCC4CCNCC4)nc3-c3ccc(-c4ccoc4)cc3)cc2)co1 |
| InChI | InChI=1S/C31H30N4O2/c1-5-25(6-2-23(1)27-11-15-36-20-27)30-31(26-7-3-24(4-8-26)28-12-16-37-21-28)35-29(19-34-30)18-33-17-22-9-13-32-14-10-22/h1-8,11-12,15-16,19-22,32-33H,9-10,13-14,17-18H2 |
| InChIKey | FBZWIWQBQTUCKA-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[5,6-bis[4-(furan-3-yl)phenyl]pyrazin-2-yl]methyl]-1-piperidin-4-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5,6-bis[4-(furan-3-yl)phenyl]pyrazin-2-yl]methyl]-1-piperidin-4-ylmethanamine?
The IUPAC name of N-[[5,6-bis[4-(furan-3-yl)phenyl]pyrazin-2-yl]methyl]-1-piperidin-4-ylmethanamine (CID 155542846) is N-[[5,6-bis[4-(furan-3-yl)phenyl]pyrazin-2-yl]methyl]-1-piperidin-4-ylmethanamine.
What is the SMILES notation for N-[[5,6-bis[4-(furan-3-yl)phenyl]pyrazin-2-yl]methyl]-1-piperidin-4-ylmethanamine?
The canonical SMILES for N-[[5,6-bis[4-(furan-3-yl)phenyl]pyrazin-2-yl]methyl]-1-piperidin-4-ylmethanamine is c1cc(-c2ccc(-c3ncc(CNCC4CCNCC4)nc3-c3ccc(-c4ccoc4)cc3)cc2)co1.
What is the InChIKey of N-[[5,6-bis[4-(furan-3-yl)phenyl]pyrazin-2-yl]methyl]-1-piperidin-4-ylmethanamine?
The InChIKey is FBZWIWQBQTUCKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H30N4O2/c1-5-25(6-2-23(1)27-11-15-36-20-27)30-31(26-7-3-24(4-8-26)28-12-16-37-21-28)35-29(19-34-30)18-33-17-22-9-13-32-14-10-22/h1-8,11-12,15-16,19-22,32-33H,9-10,13-14,17-18H2.
What are the key properties of N-[[5,6-bis[4-(furan-3-yl)phenyl]pyrazin-2-yl]methyl]-1-piperidin-4-ylmethanamine?
N-[[5,6-bis[4-(furan-3-yl)phenyl]pyrazin-2-yl]methyl]-1-piperidin-4-ylmethanamine has a molecular weight of 490.61 g/mol, XLogP of 6.42, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5,6-bis[4-(furan-3-yl)phenyl]pyrazin-2-yl]methyl]-1-piperidin-4-ylmethanamine is sourced from PubChem (CID 155542846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).