C30H21FN4O — CID 155542861
[2-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]benzimidazol-1-yl]-(2-methylphenyl)methanone (PubChem CID 155542861) has the molecular formula C30H21FN4O and a molecular weight of 472.52 g/mol. Its IUPAC name is [2-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]benzimidazol-1-yl]-(2-methylphenyl)methanone.
| Compound Name | [2-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]benzimidazol-1-yl]-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 155542861 |
| Molecular Formula | C30H21FN4O |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | [2-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]benzimidazol-1-yl]-(2-methylphenyl)methanone |
| SMILES | Cc1ccccc1C(=O)n1c(-c2cn(-c3ccccc3)nc2-c2ccc(F)cc2)nc2ccccc21 |
| InChI | InChI=1S/C30H21FN4O/c1-20-9-5-6-12-24(20)30(36)35-27-14-8-7-13-26(27)32-29(35)25-19-34(23-10-3-2-4-11-23)33-28(25)21-15-17-22(31)18-16-21/h2-19H,1H3 |
| InChIKey | FYTQHFBLSRYZPF-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |