C27H35N3O3 — CID 155542863
6-[1-(2-methylpropyl)piperidin-4-yl]-2-oxo-N-(4-phenylbutyl)-1,3-benzoxazole-3-carboxamide (PubChem CID 155542863) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is 6-[1-(2-methylpropyl)piperidin-4-yl]-2-oxo-N-(4-phenylbutyl)-1,3-benzoxazole-3-carboxamide.
| Compound Name | 6-[1-(2-methylpropyl)piperidin-4-yl]-2-oxo-N-(4-phenylbutyl)-1,3-benzoxazole-3-carboxamide |
|---|---|
| PubChem CID | 155542863 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | 6-[1-(2-methylpropyl)piperidin-4-yl]-2-oxo-N-(4-phenylbutyl)-1,3-benzoxazole-3-carboxamide |
| SMILES | CC(C)CN1CCC(c2ccc3c(c2)oc(=O)n3C(=O)NCCCCc2ccccc2)CC1 |
| InChI | InChI=1S/C27H35N3O3/c1-20(2)19-29-16-13-22(14-17-29)23-11-12-24-25(18-23)33-27(32)30(24)26(31)28-15-7-6-10-21-8-4-3-5-9-21/h3-5,8-9,11-12,18,20,22H,6-7,10,13-17,19H2,1-2H3,(H,28,31) |
| InChIKey | YXVGJXUSEAJMKU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|