About 8-(furan-2-ylmethoxy)-5,7-dihydroxy-2-(4-piperazin-1-ylphenyl)chromen-4-one
8-(furan-2-ylmethoxy)-5,7-dihydroxy-2-(4-piperazin-1-ylphenyl)chromen-4-one (PubChem CID 155542868) has the molecular formula C24H22N2O6
and a molecular weight of 434.45 g/mol. Its IUPAC name is 8-(furan-2-ylmethoxy)-5,7-dihydroxy-2-(4-piperazin-1-ylphenyl)chromen-4-one.
Molecular Properties
| Compound Name | 8-(furan-2-ylmethoxy)-5,7-dihydroxy-2-(4-piperazin-1-ylphenyl)chromen-4-one |
| PubChem CID | 155542868 |
| Molecular Formula | C24H22N2O6 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 8-(furan-2-ylmethoxy)-5,7-dihydroxy-2-(4-piperazin-1-ylphenyl)chromen-4-one |
| SMILES | O=c1cc(-c2ccc(N3CCNCC3)cc2)oc2c(OCc3ccco3)c(O)cc(O)c12 |
| InChI | InChI=1S/C24H22N2O6/c27-18-12-20(29)23(31-14-17-2-1-11-30-17)24-22(18)19(28)13-21(32-24)15-3-5-16(6-4-15)26-9-7-25-8-10-26/h1-6,11-13,25,27,29H,7-10,14H2 |
| InChIKey | MPHAWYXYXJUNOE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 8-(furan-2-ylmethoxy)-5,7-dihydroxy-2-(4-piperazin-1-ylphenyl)chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(furan-2-ylmethoxy)-5,7-dihydroxy-2-(4-piperazin-1-ylphenyl)chromen-4-one?
The IUPAC name of 8-(furan-2-ylmethoxy)-5,7-dihydroxy-2-(4-piperazin-1-ylphenyl)chromen-4-one (CID 155542868) is 8-(furan-2-ylmethoxy)-5,7-dihydroxy-2-(4-piperazin-1-ylphenyl)chromen-4-one.
What is the SMILES notation for 8-(furan-2-ylmethoxy)-5,7-dihydroxy-2-(4-piperazin-1-ylphenyl)chromen-4-one?
The canonical SMILES for 8-(furan-2-ylmethoxy)-5,7-dihydroxy-2-(4-piperazin-1-ylphenyl)chromen-4-one is O=c1cc(-c2ccc(N3CCNCC3)cc2)oc2c(OCc3ccco3)c(O)cc(O)c12.
What is the InChIKey of 8-(furan-2-ylmethoxy)-5,7-dihydroxy-2-(4-piperazin-1-ylphenyl)chromen-4-one?
The InChIKey is MPHAWYXYXJUNOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N2O6/c27-18-12-20(29)23(31-14-17-2-1-11-30-17)24-22(18)19(28)13-21(32-24)15-3-5-16(6-4-15)26-9-7-25-8-10-26/h1-6,11-13,25,27,29H,7-10,14H2.
What are the key properties of 8-(furan-2-ylmethoxy)-5,7-dihydroxy-2-(4-piperazin-1-ylphenyl)chromen-4-one?
8-(furan-2-ylmethoxy)-5,7-dihydroxy-2-(4-piperazin-1-ylphenyl)chromen-4-one has a molecular weight of 434.45 g/mol, XLogP of 3.45, 5 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(furan-2-ylmethoxy)-5,7-dihydroxy-2-(4-piperazin-1-ylphenyl)chromen-4-one is sourced from PubChem (CID 155542868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).