C15H23N6O5P — CID 155542872
3-[1-[(4-amino-2-methylpyrimidin-5-yl)methyl]triazol-4-yl]-2-diethoxyphosphorylpropanoic acid (PubChem CID 155542872) has the molecular formula C15H23N6O5P and a molecular weight of 398.36 g/mol. Its IUPAC name is 3-[1-[(4-amino-2-methylpyrimidin-5-yl)methyl]triazol-4-yl]-2-diethoxyphosphorylpropanoic acid.
| Compound Name | 3-[1-[(4-amino-2-methylpyrimidin-5-yl)methyl]triazol-4-yl]-2-diethoxyphosphorylpropanoic acid |
|---|---|
| PubChem CID | 155542872 |
| Molecular Formula | C15H23N6O5P |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 3-[1-[(4-amino-2-methylpyrimidin-5-yl)methyl]triazol-4-yl]-2-diethoxyphosphorylpropanoic acid |
| SMILES | CCOP(=O)(OCC)C(Cc1cn(Cc2cnc(C)nc2N)nn1)C(=O)O |
| InChI | InChI=1S/C15H23N6O5P/c1-4-25-27(24,26-5-2)13(15(22)23)6-12-9-21(20-19-12)8-11-7-17-10(3)18-14(11)16/h7,9,13H,4-6,8H2,1-3H3,(H,22,23)(H2,16,17,18) |
| InChIKey | RBJOZYWJKSQTRS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 155.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|