About (E)-N-methoxyindeno[1,2-b]quinoxalin-11-imine
(E)-N-methoxyindeno[1,2-b]quinoxalin-11-imine (PubChem CID 155542902) has the molecular formula C16H11N3O
and a molecular weight of 261.28 g/mol. Its IUPAC name is (E)-N-methoxyindeno[1,2-b]quinoxalin-11-imine.
Molecular Properties
| Compound Name | (E)-N-methoxyindeno[1,2-b]quinoxalin-11-imine |
| PubChem CID | 155542902 |
| Molecular Formula | C16H11N3O |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | (E)-N-methoxyindeno[1,2-b]quinoxalin-11-imine |
| SMILES | CO/N=C1\c2ccccc2-c2nc3ccccc3nc21 |
| InChI | InChI=1S/C16H11N3O/c1-20-19-15-11-7-3-2-6-10(11)14-16(15)18-13-9-5-4-8-12(13)17-14/h2-9H,1H3/b19-15+ |
| InChIKey | AHTMKHAISMVGRO-XDJHFCHBSA-N |
| XLogP | 3.01 |
| TPSA | 47.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-methoxyindeno[1,2-b]quinoxalin-11-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-methoxyindeno[1,2-b]quinoxalin-11-imine?
The IUPAC name of (E)-N-methoxyindeno[1,2-b]quinoxalin-11-imine (CID 155542902) is (E)-N-methoxyindeno[1,2-b]quinoxalin-11-imine.
What is the SMILES notation for (E)-N-methoxyindeno[1,2-b]quinoxalin-11-imine?
The canonical SMILES for (E)-N-methoxyindeno[1,2-b]quinoxalin-11-imine is CO/N=C1\c2ccccc2-c2nc3ccccc3nc21.
What is the InChIKey of (E)-N-methoxyindeno[1,2-b]quinoxalin-11-imine?
The InChIKey is AHTMKHAISMVGRO-XDJHFCHBSA-N. The full InChI is InChI=1S/C16H11N3O/c1-20-19-15-11-7-3-2-6-10(11)14-16(15)18-13-9-5-4-8-12(13)17-14/h2-9H,1H3/b19-15+.
What are the key properties of (E)-N-methoxyindeno[1,2-b]quinoxalin-11-imine?
(E)-N-methoxyindeno[1,2-b]quinoxalin-11-imine has a molecular weight of 261.28 g/mol, XLogP of 3.01, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-methoxyindeno[1,2-b]quinoxalin-11-imine is sourced from PubChem (CID 155542902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).