C40H40BrN3O — CID 155542927
(6aR,11bR)-5-[3-[5,6-dimethyl-3-(naphthalen-2-ylmethyl)benzimidazol-3-ium-1-yl]propyl]-4-methoxy-6,6a,7,11b-tetrahydroindeno[2,1-c]quinoline bromide (PubChem CID 155542927) has the molecular formula C40H40BrN3O and a molecular weight of 658.68 g/mol. Its IUPAC name is (6aR,11bR)-5-[3-[5,6-dimethyl-3-(naphthalen-2-ylmethyl)benzimidazol-3-ium-1-yl]propyl]-4-methoxy-6,6a,7,11b-tetrahydroindeno[2,1-c]quinoline bromide.
| Compound Name | (6aR,11bR)-5-[3-[5,6-dimethyl-3-(naphthalen-2-ylmethyl)benzimidazol-3-ium-1-yl]propyl]-4-methoxy-6,6a,7,11b-tetrahydroindeno[2,1-c]quinoline bromide |
|---|---|
| PubChem CID | 155542927 |
| Molecular Formula | C40H40BrN3O |
| Molecular Weight | 658.68 g/mol |
| Exact Mass | 657.24 |
| IUPAC Name | (6aR,11bR)-5-[3-[5,6-dimethyl-3-(naphthalen-2-ylmethyl)benzimidazol-3-ium-1-yl]propyl]-4-methoxy-6,6a,7,11b-tetrahydroindeno[2,1-c]quinoline bromide |
| SMILES | COc1cccc2c1N(CCCn1c[n+](Cc3ccc4ccccc4c3)c3cc(C)c(C)cc31)C[C@@H]1Cc3ccccc3[C@H]21.[Br-] |
| InChI | InChI=1S/C40H40N3O.BrH/c1-27-20-36-37(21-28(27)2)43(24-29-16-17-30-10-4-5-11-31(30)22-29)26-42(36)19-9-18-41-25-33-23-32-12-6-7-13-34(32)39(33)35-14-8-15-38(44-3)40(35)41;/h4-8,10-17,20-22,26,33,39H,9,18-19,23-25H2,1-3H3;1H/q+1;/p-1/t33-,39+;/m0./s1 |
| InChIKey | QERRQUVGKYLGLV-MJBCBKEOSA-M |
| XLogP | 4.97 |
| TPSA | 21.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.68 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|