About 1-(furan-2-ylmethyl)-2-N-methyl-6-N-phenylimidazo[4,5-c]pyridine-2,6-diamine
1-(furan-2-ylmethyl)-2-N-methyl-6-N-phenylimidazo[4,5-c]pyridine-2,6-diamine (PubChem CID 155542982) has the molecular formula C18H17N5O
and a molecular weight of 319.37 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-2-N-methyl-6-N-phenylimidazo[4,5-c]pyridine-2,6-diamine.
Molecular Properties
| Compound Name | 1-(furan-2-ylmethyl)-2-N-methyl-6-N-phenylimidazo[4,5-c]pyridine-2,6-diamine |
| PubChem CID | 155542982 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 1-(furan-2-ylmethyl)-2-N-methyl-6-N-phenylimidazo[4,5-c]pyridine-2,6-diamine |
| SMILES | CNc1nc2cnc(Nc3ccccc3)cc2n1Cc1ccco1 |
| InChI | InChI=1S/C18H17N5O/c1-19-18-22-15-11-20-17(21-13-6-3-2-4-7-13)10-16(15)23(18)12-14-8-5-9-24-14/h2-11H,12H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | UMYWGBFTJUFYQW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 67.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(furan-2-ylmethyl)-2-N-methyl-6-N-phenylimidazo[4,5-c]pyridine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(furan-2-ylmethyl)-2-N-methyl-6-N-phenylimidazo[4,5-c]pyridine-2,6-diamine?
The IUPAC name of 1-(furan-2-ylmethyl)-2-N-methyl-6-N-phenylimidazo[4,5-c]pyridine-2,6-diamine (CID 155542982) is 1-(furan-2-ylmethyl)-2-N-methyl-6-N-phenylimidazo[4,5-c]pyridine-2,6-diamine.
What is the SMILES notation for 1-(furan-2-ylmethyl)-2-N-methyl-6-N-phenylimidazo[4,5-c]pyridine-2,6-diamine?
The canonical SMILES for 1-(furan-2-ylmethyl)-2-N-methyl-6-N-phenylimidazo[4,5-c]pyridine-2,6-diamine is CNc1nc2cnc(Nc3ccccc3)cc2n1Cc1ccco1.
What is the InChIKey of 1-(furan-2-ylmethyl)-2-N-methyl-6-N-phenylimidazo[4,5-c]pyridine-2,6-diamine?
The InChIKey is UMYWGBFTJUFYQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N5O/c1-19-18-22-15-11-20-17(21-13-6-3-2-4-7-13)10-16(15)23(18)12-14-8-5-9-24-14/h2-11H,12H2,1H3,(H,19,22)(H,20,21).
What are the key properties of 1-(furan-2-ylmethyl)-2-N-methyl-6-N-phenylimidazo[4,5-c]pyridine-2,6-diamine?
1-(furan-2-ylmethyl)-2-N-methyl-6-N-phenylimidazo[4,5-c]pyridine-2,6-diamine has a molecular weight of 319.37 g/mol, XLogP of 3.86, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(furan-2-ylmethyl)-2-N-methyl-6-N-phenylimidazo[4,5-c]pyridine-2,6-diamine is sourced from PubChem (CID 155542982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).