C14H15N3S — CID 155543030
3-butyl-4-thiophen-3-yl-2H-pyrazolo[4,3-c]pyridine (PubChem CID 155543030) has the molecular formula C14H15N3S and a molecular weight of 257.36 g/mol. Its IUPAC name is 3-butyl-4-thiophen-3-yl-2H-pyrazolo[4,3-c]pyridine.
| Compound Name | 3-butyl-4-thiophen-3-yl-2H-pyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 155543030 |
| Molecular Formula | C14H15N3S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 3-butyl-4-thiophen-3-yl-2H-pyrazolo[4,3-c]pyridine |
| SMILES | CCCCc1[nH]nc2ccnc(-c3ccsc3)c12 |
| InChI | InChI=1S/C14H15N3S/c1-2-3-4-11-13-12(17-16-11)5-7-15-14(13)10-6-8-18-9-10/h5-9H,2-4H2,1H3,(H,16,17) |
| InChIKey | CPNZRADJTAKSGO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |