C10H14O8P2 — CID 155543035
[(E)-3-(2-methoxyphenyl)prop-2-enyl] phosphono hydrogen phosphate (PubChem CID 155543035) has the molecular formula C10H14O8P2 and a molecular weight of 324.16 g/mol. Its IUPAC name is [(E)-3-(2-methoxyphenyl)prop-2-enyl] phosphono hydrogen phosphate.
| Compound Name | [(E)-3-(2-methoxyphenyl)prop-2-enyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 155543035 |
| Molecular Formula | C10H14O8P2 |
| Molecular Weight | 324.16 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | [(E)-3-(2-methoxyphenyl)prop-2-enyl] phosphono hydrogen phosphate |
| SMILES | COc1ccccc1/C=C/COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C10H14O8P2/c1-16-10-7-3-2-5-9(10)6-4-8-17-20(14,15)18-19(11,12)13/h2-7H,8H2,1H3,(H,14,15)(H2,11,12,13)/b6-4+ |
| InChIKey | SJHCYBQRGDYZSR-GQCTYLIASA-N |
| XLogP | 1.93 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|