C13H10F2N6 — CID 155543062
6-N-(3,4-difluorophenyl)pyrido[3,2-d]pyrimidine-2,4,6-triamine (PubChem CID 155543062) has the molecular formula C13H10F2N6 and a molecular weight of 288.26 g/mol. Its IUPAC name is 6-N-(3,4-difluorophenyl)pyrido[3,2-d]pyrimidine-2,4,6-triamine.
| Compound Name | 6-N-(3,4-difluorophenyl)pyrido[3,2-d]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 155543062 |
| Molecular Formula | C13H10F2N6 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 6-N-(3,4-difluorophenyl)pyrido[3,2-d]pyrimidine-2,4,6-triamine |
| SMILES | Nc1nc(N)c2nc(Nc3ccc(F)c(F)c3)ccc2n1 |
| InChI | InChI=1S/C13H10F2N6/c14-7-2-1-6(5-8(7)15)18-10-4-3-9-11(20-10)12(16)21-13(17)19-9/h1-5H,(H,18,20)(H4,16,17,19,21) |
| InChIKey | CZXKISLXVHXQQN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |