About tert-butyl N-[5-[(3-chloro-4-fluorophenoxy)-(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]carbamate
tert-butyl N-[5-[(3-chloro-4-fluorophenoxy)-(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]carbamate (PubChem CID 155543108) has the molecular formula C21H19Cl2FN2O3S
and a molecular weight of 469.37 g/mol. Its IUPAC name is tert-butyl N-[5-[(3-chloro-4-fluorophenoxy)-(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[5-[(3-chloro-4-fluorophenoxy)-(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]carbamate |
| PubChem CID | 155543108 |
| Molecular Formula | C21H19Cl2FN2O3S |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | tert-butyl N-[5-[(3-chloro-4-fluorophenoxy)-(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ncc(C(Oc2ccc(F)c(Cl)c2)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C21H19Cl2FN2O3S/c1-21(2,3)29-20(27)26-19-25-11-17(30-19)18(12-4-6-13(22)7-5-12)28-14-8-9-16(24)15(23)10-14/h4-11,18H,1-3H3,(H,25,26,27) |
| InChIKey | VOSZMKAVBJFFDP-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[5-[(3-chloro-4-fluorophenoxy)-(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[5-[(3-chloro-4-fluorophenoxy)-(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]carbamate?
The IUPAC name of tert-butyl N-[5-[(3-chloro-4-fluorophenoxy)-(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]carbamate (CID 155543108) is tert-butyl N-[5-[(3-chloro-4-fluorophenoxy)-(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[5-[(3-chloro-4-fluorophenoxy)-(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[5-[(3-chloro-4-fluorophenoxy)-(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]carbamate is CC(C)(C)OC(=O)Nc1ncc(C(Oc2ccc(F)c(Cl)c2)c2ccc(Cl)cc2)s1.
What is the InChIKey of tert-butyl N-[5-[(3-chloro-4-fluorophenoxy)-(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]carbamate?
The InChIKey is VOSZMKAVBJFFDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19Cl2FN2O3S/c1-21(2,3)29-20(27)26-19-25-11-17(30-19)18(12-4-6-13(22)7-5-12)28-14-8-9-16(24)15(23)10-14/h4-11,18H,1-3H3,(H,25,26,27).
What are the key properties of tert-butyl N-[5-[(3-chloro-4-fluorophenoxy)-(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]carbamate?
tert-butyl N-[5-[(3-chloro-4-fluorophenoxy)-(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]carbamate has a molecular weight of 469.37 g/mol, XLogP of 7.10, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[5-[(3-chloro-4-fluorophenoxy)-(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]carbamate is sourced from PubChem (CID 155543108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).