C36H56O6 — CID 155543121
[(1S,4S,5R,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] (E)-hexadec-9-enoate (PubChem CID 155543121) has the molecular formula C36H56O6 and a molecular weight of 584.84 g/mol. Its IUPAC name is [(1S,4S,5R,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] (E)-hexadec-9-enoate.
| Compound Name | [(1S,4S,5R,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] (E)-hexadec-9-enoate |
|---|---|
| PubChem CID | 155543121 |
| Molecular Formula | C36H56O6 |
| Molecular Weight | 584.84 g/mol |
| Exact Mass | 584.41 |
| IUPAC Name | [(1S,4S,5R,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] (E)-hexadec-9-enoate |
| SMILES | CCCCCC/C=C/CCCCCCCC(=O)O[C@H]1C(C)=C[C@]23C(=O)[C@@H](C=C(CO)[C@@H](O)[C@@]12O)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C36H56O6/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-29(38)42-33-24(2)22-35-25(3)20-28-30(34(28,4)5)27(32(35)40)21-26(23-37)31(39)36(33,35)41/h11-12,21-22,25,27-28,30-31,33,37,39,41H,6-10,13-20,23H2,1-5H3/b12-11+/t25-,27+,28-,30+,31-,33+,35+,36-/m1/s1 |
| InChIKey | YLHSPTFKUVDKNH-MWAJQZMCSA-N |
| XLogP | 6.62 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.84 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|